C23H22N4O3 — CID 143241348
4-[1-[2-amino-5-[3-(3-aminopropanoylamino)phenyl]-3-pyridinyl]ethenyl]benzoic acid (PubChem CID 143241348) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-[1-[2-amino-5-[3-(3-aminopropanoylamino)phenyl]-3-pyridinyl]ethenyl]benzoic acid.
| Compound Name | 4-[1-[2-amino-5-[3-(3-aminopropanoylamino)phenyl]-3-pyridinyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 143241348 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 4-[1-[2-amino-5-[3-(3-aminopropanoylamino)phenyl]-3-pyridinyl]ethenyl]benzoic acid |
| SMILES | C=C(c1ccc(C(=O)O)cc1)c1cc(-c2cccc(NC(=O)CCN)c2)cnc1N |
| InChI | InChI=1S/C23H22N4O3/c1-14(15-5-7-16(8-6-15)23(29)30)20-12-18(13-26-22(20)25)17-3-2-4-19(11-17)27-21(28)9-10-24/h2-8,11-13H,1,9-10,24H2,(H2,25,26)(H,27,28)(H,29,30) |
| InChIKey | PYCUXIKCYUZYJD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |