C12H22N2 — CID 143241697
1-(3,6-dimethylheptyl)imidazole (PubChem CID 143241697) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-(3,6-dimethylheptyl)imidazole.
| Compound Name | 1-(3,6-dimethylheptyl)imidazole |
|---|---|
| PubChem CID | 143241697 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-(3,6-dimethylheptyl)imidazole |
| SMILES | CC(C)CCC(C)CCn1ccnc1 |
| InChI | InChI=1S/C12H22N2/c1-11(2)4-5-12(3)6-8-14-9-7-13-10-14/h7,9-12H,4-6,8H2,1-3H3 |
| InChIKey | VWCWFHGAMKQHAL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |