About carbonic acid;1-(3-methylpentyl)imidazole
carbonic acid;1-(3-methylpentyl)imidazole (PubChem CID 175400753) has the molecular formula C10H18N2O3
and a molecular weight of 214.27 g/mol. Its IUPAC name is carbonic acid;1-(3-methylpentyl)imidazole.
Molecular Properties
| Compound Name | carbonic acid;1-(3-methylpentyl)imidazole |
| PubChem CID | 175400753 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | carbonic acid;1-(3-methylpentyl)imidazole |
| SMILES | CCC(C)CCn1ccnc1.O=C(O)O |
| InChI | InChI=1S/C9H16N2.CH2O3/c1-3-9(2)4-6-11-7-5-10-8-11;2-1(3)4/h5,7-9H,3-4,6H2,1-2H3;(H2,2,3,4) |
| InChIKey | PQJAMMIIUWXDNV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carbonic acid;1-(3-methylpentyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;1-(3-methylpentyl)imidazole?
The IUPAC name of carbonic acid;1-(3-methylpentyl)imidazole (CID 175400753) is carbonic acid;1-(3-methylpentyl)imidazole.
What is the SMILES notation for carbonic acid;1-(3-methylpentyl)imidazole?
The canonical SMILES for carbonic acid;1-(3-methylpentyl)imidazole is CCC(C)CCn1ccnc1.O=C(O)O.
What is the InChIKey of carbonic acid;1-(3-methylpentyl)imidazole?
The InChIKey is PQJAMMIIUWXDNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2.CH2O3/c1-3-9(2)4-6-11-7-5-10-8-11;2-1(3)4/h5,7-9H,3-4,6H2,1-2H3;(H2,2,3,4).
What are the key properties of carbonic acid;1-(3-methylpentyl)imidazole?
carbonic acid;1-(3-methylpentyl)imidazole has a molecular weight of 214.27 g/mol, XLogP of 2.54, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;1-(3-methylpentyl)imidazole is sourced from PubChem (CID 175400753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).