C17H29N3 — CID 143242088
ethane;N-ethenyl-3-[2-(4-methylpiperazin-1-yl)ethyl]aniline (PubChem CID 143242088) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is ethane;N-ethenyl-3-[2-(4-methylpiperazin-1-yl)ethyl]aniline.
| Compound Name | ethane;N-ethenyl-3-[2-(4-methylpiperazin-1-yl)ethyl]aniline |
|---|---|
| PubChem CID | 143242088 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | ethane;N-ethenyl-3-[2-(4-methylpiperazin-1-yl)ethyl]aniline |
| SMILES | C=CNc1cccc(CCN2CCN(C)CC2)c1.CC |
| InChI | InChI=1S/C15H23N3.C2H6/c1-3-16-15-6-4-5-14(13-15)7-8-18-11-9-17(2)10-12-18;1-2/h3-6,13,16H,1,7-12H2,2H3;1-2H3 |
| InChIKey | HAZAHKKOVRZWGF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |