C25H29N5O2 — CID 167795587
N-[3-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]-N'-(6-methylquinolin-8-yl)oxamide (PubChem CID 167795587) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[3-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]-N'-(6-methylquinolin-8-yl)oxamide.
| Compound Name | N-[3-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]-N'-(6-methylquinolin-8-yl)oxamide |
|---|---|
| PubChem CID | 167795587 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | N-[3-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]-N'-(6-methylquinolin-8-yl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)Nc2cccc(CCN3CCN(C)CC3)c2)c2ncccc2c1 |
| InChI | InChI=1S/C25H29N5O2/c1-18-15-20-6-4-9-26-23(20)22(16-18)28-25(32)24(31)27-21-7-3-5-19(17-21)8-10-30-13-11-29(2)12-14-30/h3-7,9,15-17H,8,10-14H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | NKUCAQJINHBEDM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|