C21H29N5O3S — CID 66677091
1-[3-[2-(4-ethylsulfonylpiperazin-1-yl)ethyl]phenyl]-3-(6-methyl-3-pyridinyl)urea (PubChem CID 66677091) has the molecular formula C21H29N5O3S and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-[3-[2-(4-ethylsulfonylpiperazin-1-yl)ethyl]phenyl]-3-(6-methyl-3-pyridinyl)urea.
| Compound Name | 1-[3-[2-(4-ethylsulfonylpiperazin-1-yl)ethyl]phenyl]-3-(6-methyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 66677091 |
| Molecular Formula | C21H29N5O3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-[3-[2-(4-ethylsulfonylpiperazin-1-yl)ethyl]phenyl]-3-(6-methyl-3-pyridinyl)urea |
| SMILES | CCS(=O)(=O)N1CCN(CCc2cccc(NC(=O)Nc3ccc(C)nc3)c2)CC1 |
| InChI | InChI=1S/C21H29N5O3S/c1-3-30(28,29)26-13-11-25(12-14-26)10-9-18-5-4-6-19(15-18)23-21(27)24-20-8-7-17(2)22-16-20/h4-8,15-16H,3,9-14H2,1-2H3,(H2,23,24,27) |
| InChIKey | QDQXRAMOJQJQII-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |