About 1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone
1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone (PubChem CID 143245098) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone.
Analyze 1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone?
The IUPAC name of 1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone (CID 143245098) is 1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone.
What is the SMILES notation for 1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone?
The canonical SMILES for 1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone is COC1=CC=C=CC=C1C(C)=O.
What is the InChIKey of 1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone?
The InChIKey is KZBDEQOFCVNIJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-8(11)9-6-4-3-5-7-10(9)12-2/h4-7H,1-2H3.
What are the key properties of 1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone?
1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone has a molecular weight of 162.19 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-methoxycyclohepta-1,3,4,6-tetraen-1-yl)ethanone is sourced from PubChem (CID 143245098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).