About 6-methyl-2,3-dimethylidenepyran-4-one
6-methyl-2,3-dimethylidenepyran-4-one (PubChem CID 54010923) has the molecular formula C8H8O2
and a molecular weight of 136.15 g/mol. Its IUPAC name is 6-methyl-2,3-dimethylidenepyran-4-one.
Molecular Properties
| Compound Name | 6-methyl-2,3-dimethylidenepyran-4-one |
| PubChem CID | 54010923 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 6-methyl-2,3-dimethylidenepyran-4-one |
| SMILES | C=c1oc(C)cc(=O)c1=C |
| InChI | InChI=1S/C8H8O2/c1-5-4-8(9)6(2)7(3)10-5/h4H,2-3H2,1H3 |
| InChIKey | KSGZYOQHFIYVGV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-2,3-dimethylidenepyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,3-dimethylidenepyran-4-one?
The IUPAC name of 6-methyl-2,3-dimethylidenepyran-4-one (CID 54010923) is 6-methyl-2,3-dimethylidenepyran-4-one.
What is the SMILES notation for 6-methyl-2,3-dimethylidenepyran-4-one?
The canonical SMILES for 6-methyl-2,3-dimethylidenepyran-4-one is C=c1oc(C)cc(=O)c1=C.
What is the InChIKey of 6-methyl-2,3-dimethylidenepyran-4-one?
The InChIKey is KSGZYOQHFIYVGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2/c1-5-4-8(9)6(2)7(3)10-5/h4H,2-3H2,1H3.
What are the key properties of 6-methyl-2,3-dimethylidenepyran-4-one?
6-methyl-2,3-dimethylidenepyran-4-one has a molecular weight of 136.15 g/mol, XLogP of -0.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,3-dimethylidenepyran-4-one is sourced from PubChem (CID 54010923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).