C27H28F6N2O2 — CID 143245379
(11S)-11-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-11-phenyl-1,4-diazabicyclo[6.3.1]dodec-7-en-3-one (PubChem CID 143245379) has the molecular formula C27H28F6N2O2 and a molecular weight of 526.52 g/mol. Its IUPAC name is (11S)-11-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-11-phenyl-1,4-diazabicyclo[6.3.1]dodec-7-en-3-one.
| Compound Name | (11S)-11-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-11-phenyl-1,4-diazabicyclo[6.3.1]dodec-7-en-3-one |
|---|---|
| PubChem CID | 143245379 |
| Molecular Formula | C27H28F6N2O2 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | (11S)-11-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-11-phenyl-1,4-diazabicyclo[6.3.1]dodec-7-en-3-one |
| SMILES | CC(OC[C@@]1(c2ccccc2)CCC2=CCCNC(=O)CN1C2)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H28F6N2O2/c1-18(20-12-22(26(28,29)30)14-23(13-20)27(31,32)33)37-17-25(21-7-3-2-4-8-21)10-9-19-6-5-11-34-24(36)16-35(25)15-19/h2-4,6-8,12-14,18H,5,9-11,15-17H2,1H3,(H,34,36)/t18?,25-/m1/s1 |
| InChIKey | SBDABDALBBORFB-IXXGTQFESA-N |
| XLogP | 6.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|