C31H33F6N5O4 — CID 11621619
1-[[(5S,8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-oxo-8-phenyl-1,4-diazabicyclo[3.3.1]nonan-5-yl]methyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea (PubChem CID 11621619) has the molecular formula C31H33F6N5O4 and a molecular weight of 653.62 g/mol. Its IUPAC name is 1-[[(5S,8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-oxo-8-phenyl-1,4-diazabicyclo[3.3.1]nonan-5-yl]methyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea.
| Compound Name | 1-[[(5S,8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-oxo-8-phenyl-1,4-diazabicyclo[3.3.1]nonan-5-yl]methyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea |
|---|---|
| PubChem CID | 11621619 |
| Molecular Formula | C31H33F6N5O4 |
| Molecular Weight | 653.62 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | 1-[[(5S,8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-oxo-8-phenyl-1,4-diazabicyclo[3.3.1]nonan-5-yl]methyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea |
| SMILES | Cc1noc(C)c1NC(=O)NC[C@]12CC[C@@](CO[C@H](C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)(c3ccccc3)N(CC(=O)N1)C2 |
| InChI | InChI=1S/C31H33F6N5O4/c1-18-26(20(3)46-41-18)39-27(44)38-15-28-9-10-29(22-7-5-4-6-8-22,42(16-28)14-25(43)40-28)17-45-19(2)21-11-23(30(32,33)34)13-24(12-21)31(35,36)37/h4-8,11-13,19H,9-10,14-17H2,1-3H3,(H,40,43)(H2,38,39,44)/t19-,28+,29-/m1/s1 |
| InChIKey | GFTWWISGKDQJMN-NFXMZALSSA-N |
| XLogP | 6.09 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |