C25H26F6N2O2 — CID 162546918
N-[(2S,5S)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-phenyl-1-azabicyclo[3.1.0]hexan-5-yl]propanamide (PubChem CID 162546918) has the molecular formula C25H26F6N2O2 and a molecular weight of 500.48 g/mol. Its IUPAC name is N-[(2S,5S)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-phenyl-1-azabicyclo[3.1.0]hexan-5-yl]propanamide.
| Compound Name | N-[(2S,5S)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-phenyl-1-azabicyclo[3.1.0]hexan-5-yl]propanamide |
|---|---|
| PubChem CID | 162546918 |
| Molecular Formula | C25H26F6N2O2 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | N-[(2S,5S)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-phenyl-1-azabicyclo[3.1.0]hexan-5-yl]propanamide |
| SMILES | CCC(=O)N[C@@]12CC[C@@](CO[C@H](C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)(c3ccccc3)N1C2 |
| InChI | InChI=1S/C25H26F6N2O2/c1-3-21(34)32-23-10-9-22(33(23)14-23,18-7-5-4-6-8-18)15-35-16(2)17-11-19(24(26,27)28)13-20(12-17)25(29,30)31/h4-8,11-13,16H,3,9-10,14-15H2,1-2H3,(H,32,34)/t16-,22-,23+,33?/m1/s1 |
| InChIKey | NOSVFPZYWNNCOE-WFYQCDBOSA-N |
| XLogP | 6.03 |
| TPSA | 41.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|