C32H30F6N3O5P — CID 89279403
benzyl (8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2,4-dioxo-8-phenyl-3-phosphanyl-1,3,9-triazaspiro[4.5]decane-9-carboxylate (PubChem CID 89279403) has the molecular formula C32H30F6N3O5P and a molecular weight of 681.57 g/mol. Its IUPAC name is benzyl (8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2,4-dioxo-8-phenyl-3-phosphanyl-1,3,9-triazaspiro[4.5]decane-9-carboxylate.
| Compound Name | benzyl (8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2,4-dioxo-8-phenyl-3-phosphanyl-1,3,9-triazaspiro[4.5]decane-9-carboxylate |
|---|---|
| PubChem CID | 89279403 |
| Molecular Formula | C32H30F6N3O5P |
| Molecular Weight | 681.57 g/mol |
| Exact Mass | 681.18 |
| IUPAC Name | benzyl (8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2,4-dioxo-8-phenyl-3-phosphanyl-1,3,9-triazaspiro[4.5]decane-9-carboxylate |
| SMILES | C[C@@H](OC[C@@]1(c2ccccc2)CCC2(CN1C(=O)OCc1ccccc1)NC(=O)N(P)C2=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H30F6N3O5P/c1-20(22-14-24(31(33,34)35)16-25(15-22)32(36,37)38)46-19-30(23-10-6-3-7-11-23)13-12-29(26(42)41(47)27(43)39-29)18-40(30)28(44)45-17-21-8-4-2-5-9-21/h2-11,14-16,20H,12-13,17-19,47H2,1H3,(H,39,43)/t20-,29?,30-/m1/s1 |
| InChIKey | SWRRNELAJHYPQY-DVVOHRMSSA-N |
| XLogP | 7.21 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.57 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|