C36H36ClF6N3O4 — CID 59296941
benzyl (2S,5S)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-5-(5-chloropentanoylamino)-5-cyano-2-phenylpiperidine-1-carboxylate (PubChem CID 59296941) has the molecular formula C36H36ClF6N3O4 and a molecular weight of 724.14 g/mol. Its IUPAC name is benzyl (2S,5S)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-5-(5-chloropentanoylamino)-5-cyano-2-phenylpiperidine-1-carboxylate.
| Compound Name | benzyl (2S,5S)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-5-(5-chloropentanoylamino)-5-cyano-2-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 59296941 |
| Molecular Formula | C36H36ClF6N3O4 |
| Molecular Weight | 724.14 g/mol |
| Exact Mass | 723.23 |
| IUPAC Name | benzyl (2S,5S)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-5-(5-chloropentanoylamino)-5-cyano-2-phenylpiperidine-1-carboxylate |
| SMILES | C[C@@H](OC[C@@]1(c2ccccc2)CC[C@](C#N)(NC(=O)CCCCCl)CN1C(=O)OCc1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C36H36ClF6N3O4/c1-25(27-18-29(35(38,39)40)20-30(19-27)36(41,42)43)50-24-34(28-12-6-3-7-13-28)16-15-33(22-44,45-31(47)14-8-9-17-37)23-46(34)32(48)49-21-26-10-4-2-5-11-26/h2-7,10-13,18-20,25H,8-9,14-17,21,23-24H2,1H3,(H,45,47)/t25-,33-,34-/m1/s1 |
| InChIKey | CKPFFILYKMDYLZ-GMTUYUHMSA-N |
| XLogP | 8.92 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.14 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|