C34H33F6NO5 — CID 175025310
benzyl (2S)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-5-(2-ethoxy-2-oxoethylidene)-2-phenylpiperidine-1-carboxylate (PubChem CID 175025310) has the molecular formula C34H33F6NO5 and a molecular weight of 649.63 g/mol. Its IUPAC name is benzyl (2S)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-5-(2-ethoxy-2-oxoethylidene)-2-phenylpiperidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-5-(2-ethoxy-2-oxoethylidene)-2-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 175025310 |
| Molecular Formula | C34H33F6NO5 |
| Molecular Weight | 649.63 g/mol |
| Exact Mass | 649.23 |
| IUPAC Name | benzyl (2S)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-5-(2-ethoxy-2-oxoethylidene)-2-phenylpiperidine-1-carboxylate |
| SMILES | CCOC(=O)C=C1CC[C@@](COC(C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C34H33F6NO5/c1-3-44-30(42)16-25-14-15-32(27-12-8-5-9-13-27,41(20-25)31(43)45-21-24-10-6-4-7-11-24)22-46-23(2)26-17-28(33(35,36)37)19-29(18-26)34(38,39)40/h4-13,16-19,23H,3,14-15,20-22H2,1-2H3/t23?,32-/m1/s1 |
| InChIKey | ZBRDGHCUKKGCJW-CXMIBLNGSA-N |
| XLogP | 8.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.63 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|