C31H32F3NO4 — CID 88916072
benzyl (2S)-5-formyl-2-[1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxymethyl]-2-phenylpiperidine-1-carboxylate (PubChem CID 88916072) has the molecular formula C31H32F3NO4 and a molecular weight of 539.59 g/mol. Its IUPAC name is benzyl (2S)-5-formyl-2-[1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxymethyl]-2-phenylpiperidine-1-carboxylate.
| Compound Name | benzyl (2S)-5-formyl-2-[1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxymethyl]-2-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 88916072 |
| Molecular Formula | C31H32F3NO4 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | benzyl (2S)-5-formyl-2-[1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxymethyl]-2-phenylpiperidine-1-carboxylate |
| SMILES | Cc1cc(C(C)OC[C@@]2(c3ccccc3)CCC(C=O)CN2C(=O)OCc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H32F3NO4/c1-22-15-26(17-28(16-22)31(32,33)34)23(2)39-21-30(27-11-7-4-8-12-27)14-13-25(19-36)18-35(30)29(37)38-20-24-9-5-3-6-10-24/h3-12,15-17,19,23,25H,13-14,18,20-21H2,1-2H3/t23?,25?,30-/m1/s1 |
| InChIKey | UDIFTHFTPCTZJQ-XLERXIRNSA-N |
| XLogP | 7.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|