C33H33F3INO4 — CID 88947990
benzyl (2S)-5-[(Z)-2-iodo-3-oxoprop-1-enyl]-2-[1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxymethyl]-2-phenylpiperidine-1-carboxylate (PubChem CID 88947990) has the molecular formula C33H33F3INO4 and a molecular weight of 691.53 g/mol. Its IUPAC name is benzyl (2S)-5-[(Z)-2-iodo-3-oxoprop-1-enyl]-2-[1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxymethyl]-2-phenylpiperidine-1-carboxylate.
| Compound Name | benzyl (2S)-5-[(Z)-2-iodo-3-oxoprop-1-enyl]-2-[1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxymethyl]-2-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 88947990 |
| Molecular Formula | C33H33F3INO4 |
| Molecular Weight | 691.53 g/mol |
| Exact Mass | 691.14 |
| IUPAC Name | benzyl (2S)-5-[(Z)-2-iodo-3-oxoprop-1-enyl]-2-[1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxymethyl]-2-phenylpiperidine-1-carboxylate |
| SMILES | Cc1cc(C(C)OC[C@@]2(c3ccccc3)CCC(/C=C(\I)C=O)CN2C(=O)OCc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H33F3INO4/c1-23-15-27(18-29(16-23)33(34,35)36)24(2)42-22-32(28-11-7-4-8-12-28)14-13-26(17-30(37)20-39)19-38(32)31(40)41-21-25-9-5-3-6-10-25/h3-12,15-18,20,24,26H,13-14,19,21-22H2,1-2H3/b30-17-/t24?,26?,32-/m1/s1 |
| InChIKey | BAUJHSADMJVSBV-GZZOJRHESA-N |
| XLogP | 8.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.53 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|