C31H37F6N5O4 — CID 143245581
2-[(2S,5R)-5-[[(3,5-dimethyl-1,2-oxazol-4-yl)carbamoylamino]methyl]-2-phenylpiperidin-1-yl]acetamide;1-[(1R)-1-methoxyethyl]-3,5-bis(trifluoromethyl)benzene (PubChem CID 143245581) has the molecular formula C31H37F6N5O4 and a molecular weight of 657.66 g/mol. Its IUPAC name is 2-[(2S,5R)-5-[[(3,5-dimethyl-1,2-oxazol-4-yl)carbamoylamino]methyl]-2-phenylpiperidin-1-yl]acetamide;1-[(1R)-1-methoxyethyl]-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 2-[(2S,5R)-5-[[(3,5-dimethyl-1,2-oxazol-4-yl)carbamoylamino]methyl]-2-phenylpiperidin-1-yl]acetamide;1-[(1R)-1-methoxyethyl]-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 143245581 |
| Molecular Formula | C31H37F6N5O4 |
| Molecular Weight | 657.66 g/mol |
| Exact Mass | 657.27 |
| IUPAC Name | 2-[(2S,5R)-5-[[(3,5-dimethyl-1,2-oxazol-4-yl)carbamoylamino]methyl]-2-phenylpiperidin-1-yl]acetamide;1-[(1R)-1-methoxyethyl]-3,5-bis(trifluoromethyl)benzene |
| SMILES | CO[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Cc1noc(C)c1NC(=O)NC[C@H]1CC[C@@H](c2ccccc2)N(CC(N)=O)C1 |
| InChI | InChI=1S/C20H27N5O3.C11H10F6O/c1-13-19(14(2)28-24-13)23-20(27)22-10-15-8-9-17(16-6-4-3-5-7-16)25(11-15)12-18(21)26;1-6(18-2)7-3-8(10(12,13)14)5-9(4-7)11(15,16)17/h3-7,15,17H,8-12H2,1-2H3,(H2,21,26)(H2,22,23,27);3-6H,1-2H3/t15-,17+;6-/m11/s1 |
| InChIKey | OWKNWLCJXLCFAV-FZAUBRTESA-N |
| XLogP | 6.78 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |