C13H12N6O3S — CID 143245702
N-[1-(5-formyl-1,3-thiazol-2-yl)ethyl]-7-oxo-6,8-dihydro-5H-pteridine-4-carboxamide (PubChem CID 143245702) has the molecular formula C13H12N6O3S and a molecular weight of 332.35 g/mol. Its IUPAC name is N-[1-(5-formyl-1,3-thiazol-2-yl)ethyl]-7-oxo-6,8-dihydro-5H-pteridine-4-carboxamide.
| Compound Name | N-[1-(5-formyl-1,3-thiazol-2-yl)ethyl]-7-oxo-6,8-dihydro-5H-pteridine-4-carboxamide |
|---|---|
| PubChem CID | 143245702 |
| Molecular Formula | C13H12N6O3S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-[1-(5-formyl-1,3-thiazol-2-yl)ethyl]-7-oxo-6,8-dihydro-5H-pteridine-4-carboxamide |
| SMILES | CC(NC(=O)c1ncnc2c1NCC(=O)N2)c1ncc(C=O)s1 |
| InChI | InChI=1S/C13H12N6O3S/c1-6(13-15-2-7(4-20)23-13)18-12(22)10-9-11(17-5-16-10)19-8(21)3-14-9/h2,4-6,14H,3H2,1H3,(H,18,22)(H,16,17,19,21) |
| InChIKey | IYRYWVWQFPCSKU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|