C13H13N7O3S — CID 143245716
azane;N-[1-(5-formyl-1,3-thiazol-2-yl)ethyl]-7-oxo-8H-pteridine-4-carboxamide (PubChem CID 143245716) has the molecular formula C13H13N7O3S and a molecular weight of 347.36 g/mol. Its IUPAC name is azane;N-[1-(5-formyl-1,3-thiazol-2-yl)ethyl]-7-oxo-8H-pteridine-4-carboxamide.
| Compound Name | azane;N-[1-(5-formyl-1,3-thiazol-2-yl)ethyl]-7-oxo-8H-pteridine-4-carboxamide |
|---|---|
| PubChem CID | 143245716 |
| Molecular Formula | C13H13N7O3S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | azane;N-[1-(5-formyl-1,3-thiazol-2-yl)ethyl]-7-oxo-8H-pteridine-4-carboxamide |
| SMILES | CC(NC(=O)c1ncnc2[nH]c(=O)cnc12)c1ncc(C=O)s1.N |
| InChI | InChI=1S/C13H10N6O3S.H3N/c1-6(13-15-2-7(4-20)23-13)18-12(22)10-9-11(17-5-16-10)19-8(21)3-14-9;/h2-6H,1H3,(H,18,22)(H,16,17,19,21);1H3 |
| InChIKey | RAQHSUNQHRDRLZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 165.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|