C22H23F3N8O3 — CID 143245759
N-[3-[(E)-1-[[2-(methylamino)-6-(trifluoromethyl)-3-pyridinyl]imino]propan-2-ylideneamino]oxybut-3-en-2-yl]-7-oxo-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-4-carboxamide (PubChem CID 143245759) has the molecular formula C22H23F3N8O3 and a molecular weight of 504.47 g/mol. Its IUPAC name is N-[3-[(E)-1-[[2-(methylamino)-6-(trifluoromethyl)-3-pyridinyl]imino]propan-2-ylideneamino]oxybut-3-en-2-yl]-7-oxo-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-4-carboxamide.
| Compound Name | N-[3-[(E)-1-[[2-(methylamino)-6-(trifluoromethyl)-3-pyridinyl]imino]propan-2-ylideneamino]oxybut-3-en-2-yl]-7-oxo-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 143245759 |
| Molecular Formula | C22H23F3N8O3 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | N-[3-[(E)-1-[[2-(methylamino)-6-(trifluoromethyl)-3-pyridinyl]imino]propan-2-ylideneamino]oxybut-3-en-2-yl]-7-oxo-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-4-carboxamide |
| SMILES | C=C(O/N=C(C)/C=N/c1ccc(C(F)(F)F)nc1NC)C(C)NC(=O)c1ncnc2c1CCC(=O)N2 |
| InChI | InChI=1S/C22H23F3N8O3/c1-11(9-27-15-6-7-16(22(23,24)25)31-20(15)26-4)33-36-13(3)12(2)30-21(35)18-14-5-8-17(34)32-19(14)29-10-28-18/h6-7,9-10,12H,3,5,8H2,1-2,4H3,(H,26,31)(H,30,35)(H,28,29,32,34)/b27-9+,33-11+ |
| InChIKey | JWUIOVCVMOUHNY-LKMRPUTDSA-N |
| XLogP | 3.24 |
| TPSA | 142.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|