C22H24N2OS — CID 143246980
N,N-diethyl-4-[(E)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]aniline (PubChem CID 143246980) has the molecular formula C22H24N2OS and a molecular weight of 364.51 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]aniline.
| Compound Name | N,N-diethyl-4-[(E)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 143246980 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N,N-diethyl-4-[(E)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]aniline |
| SMILES | CCN(CC)c1ccc(/C=C/c2nc(-c3ccc(OC)cc3)cs2)cc1 |
| InChI | InChI=1S/C22H24N2OS/c1-4-24(5-2)19-11-6-17(7-12-19)8-15-22-23-21(16-26-22)18-9-13-20(25-3)14-10-18/h6-16H,4-5H2,1-3H3/b15-8+ |
| InChIKey | NIWXDSNXDFVCAC-OVCLIPMQSA-N |
| XLogP | 5.84 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|