C21H25N5O2S2 — CID 143247305
ethane;5-hydroxy-2-(3-methylbutyl)-4-(2H-pyrido[4,3-e][1,2,4]thiadiazin-3-yl)-6-thiophen-2-ylpyridazin-3-one (PubChem CID 143247305) has the molecular formula C21H25N5O2S2 and a molecular weight of 443.60 g/mol. Its IUPAC name is ethane;5-hydroxy-2-(3-methylbutyl)-4-(2H-pyrido[4,3-e][1,2,4]thiadiazin-3-yl)-6-thiophen-2-ylpyridazin-3-one.
| Compound Name | ethane;5-hydroxy-2-(3-methylbutyl)-4-(2H-pyrido[4,3-e][1,2,4]thiadiazin-3-yl)-6-thiophen-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 143247305 |
| Molecular Formula | C21H25N5O2S2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | ethane;5-hydroxy-2-(3-methylbutyl)-4-(2H-pyrido[4,3-e][1,2,4]thiadiazin-3-yl)-6-thiophen-2-ylpyridazin-3-one |
| SMILES | CC.CC(C)CCn1nc(-c2cccs2)c(O)c(C2=Nc3ccncc3SN2)c1=O |
| InChI | InChI=1S/C19H19N5O2S2.C2H6/c1-11(2)6-8-24-19(26)15(17(25)16(22-24)13-4-3-9-27-13)18-21-12-5-7-20-10-14(12)28-23-18;1-2/h3-5,7,9-11,25H,6,8H2,1-2H3,(H,21,23);1-2H3 |
| InChIKey | XPWXWXMXCBRSTO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|