C26H30N4O2 — CID 143247659
N-(2-aminophenyl)-4-[[(4Z,6Z)-5-methyl-2-oxo-8,9-dihydro-1H-cycloocta[d]imidazol-3-yl]methyl]benzamide;ethane (PubChem CID 143247659) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[(4Z,6Z)-5-methyl-2-oxo-8,9-dihydro-1H-cycloocta[d]imidazol-3-yl]methyl]benzamide;ethane.
| Compound Name | N-(2-aminophenyl)-4-[[(4Z,6Z)-5-methyl-2-oxo-8,9-dihydro-1H-cycloocta[d]imidazol-3-yl]methyl]benzamide;ethane |
|---|---|
| PubChem CID | 143247659 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N-(2-aminophenyl)-4-[[(4Z,6Z)-5-methyl-2-oxo-8,9-dihydro-1H-cycloocta[d]imidazol-3-yl]methyl]benzamide;ethane |
| SMILES | CC.CC1=C/c2c([nH]c(=O)n2Cc2ccc(C(=O)Nc3ccccc3N)cc2)CC/C=C\1 |
| InChI | InChI=1S/C24H24N4O2.C2H6/c1-16-6-2-4-9-21-22(14-16)28(24(30)27-21)15-17-10-12-18(13-11-17)23(29)26-20-8-5-3-7-19(20)25;1-2/h2-3,5-8,10-14H,4,9,15,25H2,1H3,(H,26,29)(H,27,30);1-2H3/b6-2-,16-14-; |
| InChIKey | SCOLPTYOZNWFAU-HYFBZTFRSA-N |
| XLogP | 4.99 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|