C24H34N4O2S — CID 143247761
4-cyclohexyloxy-N-[4-(methyliminomethylamino)-3-sulfanylphenyl]benzamide;N,N-dimethylmethanamine (PubChem CID 143247761) has the molecular formula C24H34N4O2S and a molecular weight of 442.63 g/mol. Its IUPAC name is 4-cyclohexyloxy-N-[4-(methyliminomethylamino)-3-sulfanylphenyl]benzamide;N,N-dimethylmethanamine.
| Compound Name | 4-cyclohexyloxy-N-[4-(methyliminomethylamino)-3-sulfanylphenyl]benzamide;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 143247761 |
| Molecular Formula | C24H34N4O2S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 4-cyclohexyloxy-N-[4-(methyliminomethylamino)-3-sulfanylphenyl]benzamide;N,N-dimethylmethanamine |
| SMILES | C/N=C/Nc1ccc(NC(=O)c2ccc(OC3CCCCC3)cc2)cc1S.CN(C)C |
| InChI | InChI=1S/C21H25N3O2S.C3H9N/c1-22-14-23-19-12-9-16(13-20(19)27)24-21(25)15-7-10-18(11-8-15)26-17-5-3-2-4-6-17;1-4(2)3/h7-14,17,27H,2-6H2,1H3,(H,22,23)(H,24,25);1-3H3 |
| InChIKey | OFJGBNMEQMQJJU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|