C10H18N2O — CID 143247986
ethane;2,3,5,6-tetramethylpyrimidin-4-one (PubChem CID 143247986) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is ethane;2,3,5,6-tetramethylpyrimidin-4-one.
| Compound Name | ethane;2,3,5,6-tetramethylpyrimidin-4-one |
|---|---|
| PubChem CID | 143247986 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | ethane;2,3,5,6-tetramethylpyrimidin-4-one |
| SMILES | CC.Cc1nc(C)n(C)c(=O)c1C |
| InChI | InChI=1S/C8H12N2O.C2H6/c1-5-6(2)9-7(3)10(4)8(5)11;1-2/h1-4H3;1-2H3 |
| InChIKey | YCVARCQOTTWBRT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |