C27H42N2O7 — CID 143248742
2,2-dimethylpropyl (3S,4R)-3-formyl-4-[[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]methyl]pyrrolidine-1-carboxylate (PubChem CID 143248742) has the molecular formula C27H42N2O7 and a molecular weight of 506.64 g/mol. Its IUPAC name is 2,2-dimethylpropyl (3S,4R)-3-formyl-4-[[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | 2,2-dimethylpropyl (3S,4R)-3-formyl-4-[[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143248742 |
| Molecular Formula | C27H42N2O7 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 2,2-dimethylpropyl (3S,4R)-3-formyl-4-[[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]methyl]pyrrolidine-1-carboxylate |
| SMILES | COCCCOc1cc(C(=O)N(C[C@@H]2CN(C(=O)OCC(C)(C)C)C[C@H]2C=O)C(C)C)ccc1OC |
| InChI | InChI=1S/C27H42N2O7/c1-19(2)29(16-21-14-28(15-22(21)17-30)26(32)36-18-27(3,4)5)25(31)20-9-10-23(34-7)24(13-20)35-12-8-11-33-6/h9-10,13,17,19,21-22H,8,11-12,14-16,18H2,1-7H3/t21-,22-/m0/s1 |
| InChIKey | KPHLELWKGWCTDM-VXKWHMMOSA-N |
| XLogP | 3.89 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|