C32H55N2O7Si — CID 68642812
CID 68642812 (PubChem CID 68642812) has the molecular formula C32H55N2O7Si and a molecular weight of 607.89 g/mol.
| Compound Name | CID 68642812 |
|---|---|
| PubChem CID | 68642812 |
| Molecular Formula | C32H55N2O7Si |
| Molecular Weight | 607.89 g/mol |
| Exact Mass | 607.38 |
| IUPAC Name | — |
| SMILES | COCCCOc1cc(C(=O)N(CC2CN(C(=O)OC(C)(C)C)CC2C(O[Si](C)C)C(C)(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C32H55N2O7Si/c1-22(2)34(29(35)23-14-15-26(38-10)27(18-23)39-17-13-16-37-9)20-24-19-33(30(36)40-32(6,7)8)21-25(24)28(31(3,4)5)41-42(11)12/h14-15,18,22,24-25,28H,13,16-17,19-21H2,1-12H3 |
| InChIKey | SHMPIEYKJGABBO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.89 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|