C33H54N3O5Si — CID 68616509
CID 68616509 (PubChem CID 68616509) has the molecular formula C33H54N3O5Si and a molecular weight of 600.90 g/mol.
| Compound Name | CID 68616509 |
|---|---|
| PubChem CID | 68616509 |
| Molecular Formula | C33H54N3O5Si |
| Molecular Weight | 600.90 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | — |
| SMILES | COCCCn1ccc2ccc(C(=O)N(C[C@@H]3CN(C(=O)OC(C)(C)C)C[C@H]3C(O[Si](C)C)C(C)(C)C)C(C)C)cc21 |
| InChI | InChI=1S/C33H54N3O5Si/c1-23(2)36(30(37)25-14-13-24-15-17-34(28(24)19-25)16-12-18-39-9)21-26-20-35(31(38)40-33(6,7)8)22-27(26)29(32(3,4)5)41-42(10)11/h13-15,17,19,23,26-27,29H,12,16,18,20-22H2,1-11H3/t26-,27+,29?/m0/s1 |
| InChIKey | PFUSRLPOHWULEI-ZDCXKQOISA-N |
| XLogP | 6.69 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.90 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|