C26H36FN3O5 — CID 59494410
tert-butyl (2R)-2-[cyclopropyl-[[5-fluoro-1-(3-methoxypropyl)indol-6-yl]methyl]carbamoyl]morpholine-4-carboxylate (PubChem CID 59494410) has the molecular formula C26H36FN3O5 and a molecular weight of 489.59 g/mol. Its IUPAC name is tert-butyl (2R)-2-[cyclopropyl-[[5-fluoro-1-(3-methoxypropyl)indol-6-yl]methyl]carbamoyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-[cyclopropyl-[[5-fluoro-1-(3-methoxypropyl)indol-6-yl]methyl]carbamoyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 59494410 |
| Molecular Formula | C26H36FN3O5 |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | tert-butyl (2R)-2-[cyclopropyl-[[5-fluoro-1-(3-methoxypropyl)indol-6-yl]methyl]carbamoyl]morpholine-4-carboxylate |
| SMILES | COCCCn1ccc2cc(F)c(CN(C(=O)[C@H]3CN(C(=O)OC(C)(C)C)CCO3)C3CC3)cc21 |
| InChI | InChI=1S/C26H36FN3O5/c1-26(2,3)35-25(32)29-11-13-34-23(17-29)24(31)30(20-6-7-20)16-19-15-22-18(14-21(19)27)8-10-28(22)9-5-12-33-4/h8,10,14-15,20,23H,5-7,9,11-13,16-17H2,1-4H3/t23-/m1/s1 |
| InChIKey | NDTCCSNHNUWZKH-HSZRJFAPSA-N |
| XLogP | 3.94 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|