C25H35FN4O5 — CID 59494664
tert-butyl (2R)-2-[cyclopropyl-[[5-fluoro-1-(3-methoxypropyl)indazol-3-yl]methyl]carbamoyl]morpholine-4-carboxylate (PubChem CID 59494664) has the molecular formula C25H35FN4O5 and a molecular weight of 490.58 g/mol. Its IUPAC name is tert-butyl (2R)-2-[cyclopropyl-[[5-fluoro-1-(3-methoxypropyl)indazol-3-yl]methyl]carbamoyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-[cyclopropyl-[[5-fluoro-1-(3-methoxypropyl)indazol-3-yl]methyl]carbamoyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 59494664 |
| Molecular Formula | C25H35FN4O5 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | tert-butyl (2R)-2-[cyclopropyl-[[5-fluoro-1-(3-methoxypropyl)indazol-3-yl]methyl]carbamoyl]morpholine-4-carboxylate |
| SMILES | COCCCn1nc(CN(C(=O)[C@H]2CN(C(=O)OC(C)(C)C)CCO2)C2CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C25H35FN4O5/c1-25(2,3)35-24(32)28-11-13-34-22(16-28)23(31)29(18-7-8-18)15-20-19-14-17(26)6-9-21(19)30(27-20)10-5-12-33-4/h6,9,14,18,22H,5,7-8,10-13,15-16H2,1-4H3/t22-/m1/s1 |
| InChIKey | VZWPEIHVTRKQQI-JOCHJYFZSA-N |
| XLogP | 3.34 |
| TPSA | 86.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|