C33H43N3O5 — CID 59494867
tert-butyl (2R)-2-[[3-benzyl-1-(3-methoxypropyl)indol-6-yl]methyl-cyclopropylcarbamoyl]morpholine-4-carboxylate (PubChem CID 59494867) has the molecular formula C33H43N3O5 and a molecular weight of 561.72 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[3-benzyl-1-(3-methoxypropyl)indol-6-yl]methyl-cyclopropylcarbamoyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[3-benzyl-1-(3-methoxypropyl)indol-6-yl]methyl-cyclopropylcarbamoyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 59494867 |
| Molecular Formula | C33H43N3O5 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | tert-butyl (2R)-2-[[3-benzyl-1-(3-methoxypropyl)indol-6-yl]methyl-cyclopropylcarbamoyl]morpholine-4-carboxylate |
| SMILES | COCCCn1cc(Cc2ccccc2)c2ccc(CN(C(=O)[C@H]3CN(C(=O)OC(C)(C)C)CCO3)C3CC3)cc21 |
| InChI | InChI=1S/C33H43N3O5/c1-33(2,3)41-32(38)35-16-18-40-30(23-35)31(37)36(27-12-13-27)21-25-11-14-28-26(19-24-9-6-5-7-10-24)22-34(29(28)20-25)15-8-17-39-4/h5-7,9-11,14,20,22,27,30H,8,12-13,15-19,21,23H2,1-4H3/t30-/m1/s1 |
| InChIKey | CBHKPFITNBAWER-SSEXGKCCSA-N |
| XLogP | 5.40 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|