C28H43N3O5 — CID 59494779
tert-butyl (2R)-2-[[1-(3-methoxypropyl)indol-3-yl]methyl-pentan-3-ylcarbamoyl]morpholine-4-carboxylate (PubChem CID 59494779) has the molecular formula C28H43N3O5 and a molecular weight of 501.67 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[1-(3-methoxypropyl)indol-3-yl]methyl-pentan-3-ylcarbamoyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[1-(3-methoxypropyl)indol-3-yl]methyl-pentan-3-ylcarbamoyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 59494779 |
| Molecular Formula | C28H43N3O5 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | tert-butyl (2R)-2-[[1-(3-methoxypropyl)indol-3-yl]methyl-pentan-3-ylcarbamoyl]morpholine-4-carboxylate |
| SMILES | CCC(CC)N(Cc1cn(CCCOC)c2ccccc12)C(=O)[C@H]1CN(C(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C28H43N3O5/c1-7-22(8-2)31(26(32)25-20-30(15-17-35-25)27(33)36-28(3,4)5)19-21-18-29(14-11-16-34-6)24-13-10-9-12-23(21)24/h9-10,12-13,18,22,25H,7-8,11,14-17,19-20H2,1-6H3/t25-/m1/s1 |
| InChIKey | AELIBLUABAFHRZ-RUZDIDTESA-N |
| XLogP | 4.83 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|