C31H46N4O5 — CID 59494198
tert-butyl 2-[[3-cyclohexyl-1-(3-methoxypropyl)indazol-6-yl]methyl-cyclopropylcarbamoyl]morpholine-4-carboxylate (PubChem CID 59494198) has the molecular formula C31H46N4O5 and a molecular weight of 554.73 g/mol. Its IUPAC name is tert-butyl 2-[[3-cyclohexyl-1-(3-methoxypropyl)indazol-6-yl]methyl-cyclopropylcarbamoyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[[3-cyclohexyl-1-(3-methoxypropyl)indazol-6-yl]methyl-cyclopropylcarbamoyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 59494198 |
| Molecular Formula | C31H46N4O5 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | tert-butyl 2-[[3-cyclohexyl-1-(3-methoxypropyl)indazol-6-yl]methyl-cyclopropylcarbamoyl]morpholine-4-carboxylate |
| SMILES | COCCCn1nc(C2CCCCC2)c2ccc(CN(C(=O)C3CN(C(=O)OC(C)(C)C)CCO3)C3CC3)cc21 |
| InChI | InChI=1S/C31H46N4O5/c1-31(2,3)40-30(37)33-16-18-39-27(21-33)29(36)34(24-12-13-24)20-22-11-14-25-26(19-22)35(15-8-17-38-4)32-28(25)23-9-6-5-7-10-23/h11,14,19,23-24,27H,5-10,12-13,15-18,20-21H2,1-4H3 |
| InChIKey | CJODXIDIPIAQOH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 86.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|