C25H35ClN4O5 — CID 59494962
tert-butyl (2R)-2-[[4-chloro-1-(3-methoxypropyl)indazol-6-yl]methyl-cyclopropylcarbamoyl]morpholine-4-carboxylate (PubChem CID 59494962) has the molecular formula C25H35ClN4O5 and a molecular weight of 507.03 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[4-chloro-1-(3-methoxypropyl)indazol-6-yl]methyl-cyclopropylcarbamoyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[4-chloro-1-(3-methoxypropyl)indazol-6-yl]methyl-cyclopropylcarbamoyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 59494962 |
| Molecular Formula | C25H35ClN4O5 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | tert-butyl (2R)-2-[[4-chloro-1-(3-methoxypropyl)indazol-6-yl]methyl-cyclopropylcarbamoyl]morpholine-4-carboxylate |
| SMILES | COCCCn1ncc2c(Cl)cc(CN(C(=O)[C@H]3CN(C(=O)OC(C)(C)C)CCO3)C3CC3)cc21 |
| InChI | InChI=1S/C25H35ClN4O5/c1-25(2,3)35-24(32)28-9-11-34-22(16-28)23(31)29(18-6-7-18)15-17-12-20(26)19-14-27-30(21(19)13-17)8-5-10-33-4/h12-14,18,22H,5-11,15-16H2,1-4H3/t22-/m1/s1 |
| InChIKey | SCKQBCQLWXMABD-JOCHJYFZSA-N |
| XLogP | 3.85 |
| TPSA | 86.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|