C20H27ClN4O3 — CID 59494659
N-[[4-chloro-1-(3-methoxypropyl)indazol-6-yl]methyl]-N-cyclopropylmorpholine-2-carboxamide (PubChem CID 59494659) has the molecular formula C20H27ClN4O3 and a molecular weight of 406.91 g/mol. Its IUPAC name is N-[[4-chloro-1-(3-methoxypropyl)indazol-6-yl]methyl]-N-cyclopropylmorpholine-2-carboxamide.
| Compound Name | N-[[4-chloro-1-(3-methoxypropyl)indazol-6-yl]methyl]-N-cyclopropylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 59494659 |
| Molecular Formula | C20H27ClN4O3 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-[[4-chloro-1-(3-methoxypropyl)indazol-6-yl]methyl]-N-cyclopropylmorpholine-2-carboxamide |
| SMILES | COCCCn1ncc2c(Cl)cc(CN(C(=O)C3CNCCO3)C3CC3)cc21 |
| InChI | InChI=1S/C20H27ClN4O3/c1-27-7-2-6-25-18-10-14(9-17(21)16(18)11-23-25)13-24(15-3-4-15)20(26)19-12-22-5-8-28-19/h9-11,15,19,22H,2-8,12-13H2,1H3 |
| InChIKey | ARQVUSSKWCDPGL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|