C26H35ClN2O5 — CID 67543478
(2R)-N-cyclopropyl-N-[[3-(3-methoxypropoxy)-5-phenylmethoxyphenyl]methyl]morpholine-2-carboxamide;hydrochloride (PubChem CID 67543478) has the molecular formula C26H35ClN2O5 and a molecular weight of 491.03 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-N-[[3-(3-methoxypropoxy)-5-phenylmethoxyphenyl]methyl]morpholine-2-carboxamide;hydrochloride.
| Compound Name | (2R)-N-cyclopropyl-N-[[3-(3-methoxypropoxy)-5-phenylmethoxyphenyl]methyl]morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67543478 |
| Molecular Formula | C26H35ClN2O5 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | (2R)-N-cyclopropyl-N-[[3-(3-methoxypropoxy)-5-phenylmethoxyphenyl]methyl]morpholine-2-carboxamide;hydrochloride |
| SMILES | COCCCOc1cc(CN(C(=O)[C@H]2CNCCO2)C2CC2)cc(OCc2ccccc2)c1.Cl |
| InChI | InChI=1S/C26H34N2O5.ClH/c1-30-11-5-12-31-23-14-21(15-24(16-23)33-19-20-6-3-2-4-7-20)18-28(22-8-9-22)26(29)25-17-27-10-13-32-25;/h2-4,6-7,14-16,22,25,27H,5,8-13,17-19H2,1H3;1H/t25-;/m1./s1 |
| InChIKey | DWNSZSRPDXHJGO-VQIWEWKSSA-N |
| XLogP | 3.58 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|