C22H31ClN4O4 — CID 89026730
methyl N-[3-[3-chloro-6-[[cyclopropyl(morpholine-2-carbonyl)amino]methyl]-2,3-dihydroindol-1-yl]propyl]carbamate (PubChem CID 89026730) has the molecular formula C22H31ClN4O4 and a molecular weight of 450.97 g/mol. Its IUPAC name is methyl N-[3-[3-chloro-6-[[cyclopropyl(morpholine-2-carbonyl)amino]methyl]-2,3-dihydroindol-1-yl]propyl]carbamate.
| Compound Name | methyl N-[3-[3-chloro-6-[[cyclopropyl(morpholine-2-carbonyl)amino]methyl]-2,3-dihydroindol-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 89026730 |
| Molecular Formula | C22H31ClN4O4 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | methyl N-[3-[3-chloro-6-[[cyclopropyl(morpholine-2-carbonyl)amino]methyl]-2,3-dihydroindol-1-yl]propyl]carbamate |
| SMILES | COC(=O)NCCCN1CC(Cl)c2ccc(CN(C(=O)C3CNCCO3)C3CC3)cc21 |
| InChI | InChI=1S/C22H31ClN4O4/c1-30-22(29)25-7-2-9-26-14-18(23)17-6-3-15(11-19(17)26)13-27(16-4-5-16)21(28)20-12-24-8-10-31-20/h3,6,11,16,18,20,24H,2,4-5,7-10,12-14H2,1H3,(H,25,29) |
| InChIKey | DOPRLTBDHONXPW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|