C27H45N3O6S — CID 143248806
N-[[(3S)-4-(cyclohexylmethylsulfonylamino)pyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide (PubChem CID 143248806) has the molecular formula C27H45N3O6S and a molecular weight of 539.74 g/mol. Its IUPAC name is N-[[(3S)-4-(cyclohexylmethylsulfonylamino)pyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide.
| Compound Name | N-[[(3S)-4-(cyclohexylmethylsulfonylamino)pyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 143248806 |
| Molecular Formula | C27H45N3O6S |
| Molecular Weight | 539.74 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | N-[[(3S)-4-(cyclohexylmethylsulfonylamino)pyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
| SMILES | COCCCOc1cc(C(=O)N(C[C@@H]2CNCC2NS(=O)(=O)CC2CCCCC2)C(C)C)ccc1OC |
| InChI | InChI=1S/C27H45N3O6S/c1-20(2)30(27(31)22-11-12-25(35-4)26(15-22)36-14-8-13-34-3)18-23-16-28-17-24(23)29-37(32,33)19-21-9-6-5-7-10-21/h11-12,15,20-21,23-24,28-29H,5-10,13-14,16-19H2,1-4H3/t23-,24?/m0/s1 |
| InChIKey | ZOEHLOWNLSVVMD-UXMRNZNESA-N |
| XLogP | 3.05 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.74 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|