C24H39N3O4 — CID 59272068
N-[[(3R,4R)-4-(cyclobutylamino)pyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide (PubChem CID 59272068) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is N-[[(3R,4R)-4-(cyclobutylamino)pyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide.
| Compound Name | N-[[(3R,4R)-4-(cyclobutylamino)pyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 59272068 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | N-[[(3R,4R)-4-(cyclobutylamino)pyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
| SMILES | COCCCOc1cc(C(=O)N(C[C@H]2CNC[C@@H]2NC2CCC2)C(C)C)ccc1OC |
| InChI | InChI=1S/C24H39N3O4/c1-17(2)27(16-19-14-25-15-21(19)26-20-7-5-8-20)24(28)18-9-10-22(30-4)23(13-18)31-12-6-11-29-3/h9-10,13,17,19-21,25-26H,5-8,11-12,14-16H2,1-4H3/t19-,21+/m1/s1 |
| InChIKey | ZAFIBOYSLAJJSG-CTNGQTDRSA-N |
| XLogP | 2.69 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|