About ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide
ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide (PubChem CID 143250244) has the molecular formula C15H31N3
and a molecular weight of 253.43 g/mol. Its IUPAC name is ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide.
Molecular Properties
| Compound Name | ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide |
| PubChem CID | 143250244 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide |
| SMILES | CC.CC.CCCC1CCNCC1/C(C#N)=N/C |
| InChI | InChI=1S/C11H19N3.2C2H6/c1-3-4-9-5-6-14-8-10(9)11(7-12)13-2;2*1-2/h9-10,14H,3-6,8H2,1-2H3;2*1-2H3/b13-11+;; |
| InChIKey | QFTCGIVMRYEWGC-UAIOKUCGSA-N |
| XLogP | 3.66 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide?
The IUPAC name of ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide (CID 143250244) is ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide.
What is the SMILES notation for ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide?
The canonical SMILES for ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide is CC.CC.CCCC1CCNCC1/C(C#N)=N/C.
What is the InChIKey of ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide?
The InChIKey is QFTCGIVMRYEWGC-UAIOKUCGSA-N. The full InChI is InChI=1S/C11H19N3.2C2H6/c1-3-4-9-5-6-14-8-10(9)11(7-12)13-2;2*1-2/h9-10,14H,3-6,8H2,1-2H3;2*1-2H3/b13-11+;;.
What are the key properties of ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide?
ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide has a molecular weight of 253.43 g/mol, XLogP of 3.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-4-propylpiperidine-3-carboximidoyl cyanide is sourced from PubChem (CID 143250244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).