C22H16ClN5O3S — CID 143250344
N-(6-aminosulfanyl-2-methyl-3-pyridinyl)-2-[4-chloro-2-(3,5-dicyanophenoxy)phenoxy]acetamide (PubChem CID 143250344) has the molecular formula C22H16ClN5O3S and a molecular weight of 465.92 g/mol. Its IUPAC name is N-(6-aminosulfanyl-2-methyl-3-pyridinyl)-2-[4-chloro-2-(3,5-dicyanophenoxy)phenoxy]acetamide.
| Compound Name | N-(6-aminosulfanyl-2-methyl-3-pyridinyl)-2-[4-chloro-2-(3,5-dicyanophenoxy)phenoxy]acetamide |
|---|---|
| PubChem CID | 143250344 |
| Molecular Formula | C22H16ClN5O3S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | N-(6-aminosulfanyl-2-methyl-3-pyridinyl)-2-[4-chloro-2-(3,5-dicyanophenoxy)phenoxy]acetamide |
| SMILES | Cc1nc(SN)ccc1NC(=O)COc1ccc(Cl)cc1Oc1cc(C#N)cc(C#N)c1 |
| InChI | InChI=1S/C22H16ClN5O3S/c1-13-18(3-5-22(27-13)32-26)28-21(29)12-30-19-4-2-16(23)9-20(19)31-17-7-14(10-24)6-15(8-17)11-25/h2-9H,12,26H2,1H3,(H,28,29) |
| InChIKey | FTCGYLVUIISGGZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 134.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|