C19H34O2 — CID 143250461
1-(4,6-dimethyl-7-oxabicyclo[4.1.0]heptan-3-yl)-9-methyldecan-1-one (PubChem CID 143250461) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is 1-(4,6-dimethyl-7-oxabicyclo[4.1.0]heptan-3-yl)-9-methyldecan-1-one.
| Compound Name | 1-(4,6-dimethyl-7-oxabicyclo[4.1.0]heptan-3-yl)-9-methyldecan-1-one |
|---|---|
| PubChem CID | 143250461 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | 1-(4,6-dimethyl-7-oxabicyclo[4.1.0]heptan-3-yl)-9-methyldecan-1-one |
| SMILES | CC(C)CCCCCCCC(=O)C1CC2OC2(C)CC1C |
| InChI | InChI=1S/C19H34O2/c1-14(2)10-8-6-5-7-9-11-17(20)16-12-18-19(4,21-18)13-15(16)3/h14-16,18H,5-13H2,1-4H3 |
| InChIKey | HLZDVQWOAFPDOT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|