About 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate
2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate (PubChem CID 143250970) has the molecular formula C14H28N4O
and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate |
| PubChem CID | 143250970 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate |
| SMILES | [H]/N=C(\OCCN1CCCCC1)N(C)/C(=N/[H])C(C)CC |
| InChI | InChI=1S/C14H28N4O/c1-4-12(2)13(15)17(3)14(16)19-11-10-18-8-6-5-7-9-18/h12,15-16H,4-11H2,1-3H3/b15-13+,16-14- |
| InChIKey | QJANYNKTQSFTOF-ZNOBWPMYSA-N |
| XLogP | 2.38 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate?
The IUPAC name of 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate (CID 143250970) is 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate.
What is the SMILES notation for 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate?
The canonical SMILES for 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate is [H]/N=C(\OCCN1CCCCC1)N(C)/C(=N/[H])C(C)CC.
What is the InChIKey of 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate?
The InChIKey is QJANYNKTQSFTOF-ZNOBWPMYSA-N. The full InChI is InChI=1S/C14H28N4O/c1-4-12(2)13(15)17(3)14(16)19-11-10-18-8-6-5-7-9-18/h12,15-16H,4-11H2,1-3H3/b15-13+,16-14-.
What are the key properties of 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate?
2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate has a molecular weight of 268.40 g/mol, XLogP of 2.38, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl N-methyl-N-(2-methylbutanimidoyl)carbamimidate is sourced from PubChem (CID 143250970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).