C16H30N2O2 — CID 143251131
[(3Z,5E)-8-(dimethylamino)-7-methylnona-3,5-dien-5-yl] N-ethyl-N-methylcarbamate (PubChem CID 143251131) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is [(3Z,5E)-8-(dimethylamino)-7-methylnona-3,5-dien-5-yl] N-ethyl-N-methylcarbamate.
| Compound Name | [(3Z,5E)-8-(dimethylamino)-7-methylnona-3,5-dien-5-yl] N-ethyl-N-methylcarbamate |
|---|---|
| PubChem CID | 143251131 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | [(3Z,5E)-8-(dimethylamino)-7-methylnona-3,5-dien-5-yl] N-ethyl-N-methylcarbamate |
| SMILES | CC/C=C\C(=C/C(C)C(C)N(C)C)OC(=O)N(C)CC |
| InChI | InChI=1S/C16H30N2O2/c1-8-10-11-15(20-16(19)18(7)9-2)12-13(3)14(4)17(5)6/h10-14H,8-9H2,1-7H3/b11-10-,15-12+ |
| InChIKey | HZRVOCHWPVWVCN-WTPCJXRQSA-N |
| XLogP | 3.51 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|