C16H20ClN5 — CID 143251197
3-[(6-chloro-5-methylcyclohexa-1,3-dien-1-yl)methyl]-1-propylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 143251197) has the molecular formula C16H20ClN5 and a molecular weight of 317.82 g/mol. Its IUPAC name is 3-[(6-chloro-5-methylcyclohexa-1,3-dien-1-yl)methyl]-1-propylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-[(6-chloro-5-methylcyclohexa-1,3-dien-1-yl)methyl]-1-propylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143251197 |
| Molecular Formula | C16H20ClN5 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-[(6-chloro-5-methylcyclohexa-1,3-dien-1-yl)methyl]-1-propylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCn1nc(CC2=CC=CC(C)C2Cl)c2c(N)ncnc21 |
| InChI | InChI=1S/C16H20ClN5/c1-3-7-22-16-13(15(18)19-9-20-16)12(21-22)8-11-6-4-5-10(2)14(11)17/h4-6,9-10,14H,3,7-8H2,1-2H3,(H2,18,19,20) |
| InChIKey | RMWSJMOKFRDWRZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|