C8H14N2O2 — CID 143251897
ethane;5-methyl-6-methylidene-1,3-diazinane-2,4-dione (PubChem CID 143251897) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is ethane;5-methyl-6-methylidene-1,3-diazinane-2,4-dione.
| Compound Name | ethane;5-methyl-6-methylidene-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 143251897 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | ethane;5-methyl-6-methylidene-1,3-diazinane-2,4-dione |
| SMILES | C=C1NC(=O)NC(=O)C1C.CC |
| InChI | InChI=1S/C6H8N2O2.C2H6/c1-3-4(2)7-6(10)8-5(3)9;1-2/h3H,2H2,1H3,(H2,7,8,9,10);1-2H3 |
| InChIKey | ZLLSFBRRDLEBLZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |