C6H8N2O3 — CID 143325770
(6E)-6-(hydroxymethylidene)-5-methyl-1,3-diazinane-2,4-dione (PubChem CID 143325770) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is (6E)-6-(hydroxymethylidene)-5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | (6E)-6-(hydroxymethylidene)-5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 143325770 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | (6E)-6-(hydroxymethylidene)-5-methyl-1,3-diazinane-2,4-dione |
| SMILES | CC1C(=O)NC(=O)N/C1=C/O |
| InChI | InChI=1S/C6H8N2O3/c1-3-4(2-9)7-6(11)8-5(3)10/h2-3,9H,1H3,(H2,7,8,10,11)/b4-2+ |
| InChIKey | KWNMFRQMQXXRLJ-DUXPYHPUSA-N |
| XLogP | -0.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|