C32H12F14O3 — CID 143253093
3,5-bis[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenol (PubChem CID 143253093) has the molecular formula C32H12F14O3 and a molecular weight of 710.42 g/mol. Its IUPAC name is 3,5-bis[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenol.
| Compound Name | 3,5-bis[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenol |
|---|---|
| PubChem CID | 143253093 |
| Molecular Formula | C32H12F14O3 |
| Molecular Weight | 710.42 g/mol |
| Exact Mass | 710.06 |
| IUPAC Name | 3,5-bis[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenol |
| SMILES | Oc1cc(-c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)cc(-c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)c1 |
| InChI | InChI=1S/C32H12F14O3/c33-19-4-14(5-20(34)27(19)31(43,44)48-17-8-23(37)29(41)24(38)9-17)12-1-13(3-16(47)2-12)15-6-21(35)28(22(36)7-15)32(45,46)49-18-10-25(39)30(42)26(40)11-18/h1-11,47H |
| InChIKey | TZYQBXIROPGSAW-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.42 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|