C12H15NS — CID 143253685
8,8-dimethyl-2,4-dihydro-1H-cyclohepta[c]pyridine-3-thione (PubChem CID 143253685) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 8,8-dimethyl-2,4-dihydro-1H-cyclohepta[c]pyridine-3-thione.
| Compound Name | 8,8-dimethyl-2,4-dihydro-1H-cyclohepta[c]pyridine-3-thione |
|---|---|
| PubChem CID | 143253685 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 8,8-dimethyl-2,4-dihydro-1H-cyclohepta[c]pyridine-3-thione |
| SMILES | CC1(C)C=CC=C2CC(=S)NCC2=C1 |
| InChI | InChI=1S/C12H15NS/c1-12(2)5-3-4-9-6-11(14)13-8-10(9)7-12/h3-5,7H,6,8H2,1-2H3,(H,13,14) |
| InChIKey | FHMFAQNEDJRQOE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|