C23H23Cl2N5O — CID 143256464
1-[3-butyl-1-(1-methylindol-5-yl)pyrazol-5-yl]-3-(2,3-dichlorophenyl)urea (PubChem CID 143256464) has the molecular formula C23H23Cl2N5O and a molecular weight of 456.38 g/mol. Its IUPAC name is 1-[3-butyl-1-(1-methylindol-5-yl)pyrazol-5-yl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[3-butyl-1-(1-methylindol-5-yl)pyrazol-5-yl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 143256464 |
| Molecular Formula | C23H23Cl2N5O |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 1-[3-butyl-1-(1-methylindol-5-yl)pyrazol-5-yl]-3-(2,3-dichlorophenyl)urea |
| SMILES | CCCCc1cc(NC(=O)Nc2cccc(Cl)c2Cl)n(-c2ccc3c(ccn3C)c2)n1 |
| InChI | InChI=1S/C23H23Cl2N5O/c1-3-4-6-16-14-21(27-23(31)26-19-8-5-7-18(24)22(19)25)30(28-16)17-9-10-20-15(13-17)11-12-29(20)2/h5,7-14H,3-4,6H2,1-2H3,(H2,26,27,31) |
| InChIKey | OLKDLZPFDJAWIB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |